C17H31N3O3 — CID 56796664
1-[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 56796664) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56796664 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 1-[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CC1CCCCC1OCCNC(=O)CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H31N3O3/c1-13-4-2-3-5-15(13)23-11-8-19-16(21)12-20-9-6-14(7-10-20)17(18)22/h13-15H,2-12H2,1H3,(H2,18,22)(H,19,21) |
| InChIKey | JJKDTNRVPBDESV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|