C10H15N3O5S — CID 7253846
5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-1H-pyrimidine-2,4-dione (PubChem CID 7253846) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7253846 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-1H-pyrimidine-2,4-dione |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2c[nH]c(=O)[nH]c2=O)C[C@@H](C)O1 |
| InChI | InChI=1S/C10H15N3O5S/c1-6-4-13(5-7(2)18-6)19(16,17)8-3-11-10(15)12-9(8)14/h3,6-7H,4-5H2,1-2H3,(H2,11,12,14,15)/t6-,7-/m1/s1 |
| InChIKey | YRJXWCZLWMBNOY-RNFRBKRXSA-N |
| XLogP | -1.14 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |