C10H15N3O3 — CID 21178136
5-(2,6-dimethylmorpholin-4-yl)-1H-pyrimidine-2,4-dione (PubChem CID 21178136) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 5-(2,6-dimethylmorpholin-4-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2,6-dimethylmorpholin-4-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21178136 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 5-(2,6-dimethylmorpholin-4-yl)-1H-pyrimidine-2,4-dione |
| SMILES | CC1CN(c2c[nH]c(=O)[nH]c2=O)CC(C)O1 |
| InChI | InChI=1S/C10H15N3O3/c1-6-4-13(5-7(2)16-6)8-3-11-10(15)12-9(8)14/h3,6-7H,4-5H2,1-2H3,(H2,11,12,14,15) |
| InChIKey | PZMRCUJAXCCDMC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |