C14H15ClN2O3 — CID 104958978
5-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1H-indole-2,3-dione (PubChem CID 104958978) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 5-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 104958978 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-1H-indole-2,3-dione |
| SMILES | C[C@@H]1CN(c2cc3c(cc2Cl)C(=O)C(=O)N3)C[C@H](C)O1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-7-5-17(6-8(2)20-7)12-4-11-9(3-10(12)15)13(18)14(19)16-11/h3-4,7-8H,5-6H2,1-2H3,(H,16,18,19)/t7-,8+ |
| InChIKey | GLGPQSAJYWKXJS-OCAPTIKFSA-N |
| XLogP | 2.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|