C15H18BrN3O2 — CID 81452606
5-bromo-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-1H-indole-2,3-dione (PubChem CID 81452606) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is 5-bromo-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-1H-indole-2,3-dione.
| Compound Name | 5-bromo-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 81452606 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 5-bromo-6-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-1H-indole-2,3-dione |
| SMILES | CC1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)CC1N(C)C |
| InChI | InChI=1S/C15H18BrN3O2/c1-8-6-19(7-13(8)18(2)3)12-5-11-9(4-10(12)16)14(20)15(21)17-11/h4-5,8,13H,6-7H2,1-3H3,(H,17,20,21) |
| InChIKey | VFNIIBAODQUZDY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|