C14H14BrN3O3 — CID 79343448
5-bromo-6-(2,2-dimethyl-3-oxopiperazin-1-yl)-1H-indole-2,3-dione (PubChem CID 79343448) has the molecular formula C14H14BrN3O3 and a molecular weight of 352.19 g/mol. Its IUPAC name is 5-bromo-6-(2,2-dimethyl-3-oxopiperazin-1-yl)-1H-indole-2,3-dione.
| Compound Name | 5-bromo-6-(2,2-dimethyl-3-oxopiperazin-1-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79343448 |
| Molecular Formula | C14H14BrN3O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 5-bromo-6-(2,2-dimethyl-3-oxopiperazin-1-yl)-1H-indole-2,3-dione |
| SMILES | CC1(C)C(=O)NCCN1c1cc2c(cc1Br)C(=O)C(=O)N2 |
| InChI | InChI=1S/C14H14BrN3O3/c1-14(2)13(21)16-3-4-18(14)10-6-9-7(5-8(10)15)11(19)12(20)17-9/h5-6H,3-4H2,1-2H3,(H,16,21)(H,17,19,20) |
| InChIKey | GYQSVFOOWVOCCY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|