C13H13BrN2O3 — CID 103356460
5-bromo-6-(3-hydroxy-3-methylpyrrolidin-1-yl)-1H-indole-2,3-dione (PubChem CID 103356460) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is 5-bromo-6-(3-hydroxy-3-methylpyrrolidin-1-yl)-1H-indole-2,3-dione.
| Compound Name | 5-bromo-6-(3-hydroxy-3-methylpyrrolidin-1-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 103356460 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 5-bromo-6-(3-hydroxy-3-methylpyrrolidin-1-yl)-1H-indole-2,3-dione |
| SMILES | CC1(O)CCN(c2cc3c(cc2Br)C(=O)C(=O)N3)C1 |
| InChI | InChI=1S/C13H13BrN2O3/c1-13(19)2-3-16(6-13)10-5-9-7(4-8(10)14)11(17)12(18)15-9/h4-5,19H,2-3,6H2,1H3,(H,15,17,18) |
| InChIKey | SDLFQAORYLDUMN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|