C12H10ClN3O3 — CID 79336846
5-chloro-6-(3-oxopiperazin-1-yl)-1H-indole-2,3-dione (PubChem CID 79336846) has the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. Its IUPAC name is 5-chloro-6-(3-oxopiperazin-1-yl)-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-(3-oxopiperazin-1-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79336846 |
| Molecular Formula | C12H10ClN3O3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-chloro-6-(3-oxopiperazin-1-yl)-1H-indole-2,3-dione |
| SMILES | O=C1CN(c2cc3c(cc2Cl)C(=O)C(=O)N3)CCN1 |
| InChI | InChI=1S/C12H10ClN3O3/c13-7-3-6-8(15-12(19)11(6)18)4-9(7)16-2-1-14-10(17)5-16/h3-4H,1-2,5H2,(H,14,17)(H,15,18,19) |
| InChIKey | SUBVTIFBDOOSQS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|