C15H17ClN2O2 — CID 79336164
5-chloro-6-(2,5-dimethylpiperidin-1-yl)-1H-indole-2,3-dione (PubChem CID 79336164) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 5-chloro-6-(2,5-dimethylpiperidin-1-yl)-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-(2,5-dimethylpiperidin-1-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79336164 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-chloro-6-(2,5-dimethylpiperidin-1-yl)-1H-indole-2,3-dione |
| SMILES | CC1CCC(C)N(c2cc3c(cc2Cl)C(=O)C(=O)N3)C1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-8-3-4-9(2)18(7-8)13-6-12-10(5-11(13)16)14(19)15(20)17-12/h5-6,8-9H,3-4,7H2,1-2H3,(H,17,19,20) |
| InChIKey | GZYCHXGXVWTWKL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|