About 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione
5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione (PubChem CID 80758039) has the molecular formula C13H13FN2O2S
and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione.
Molecular Properties
| Compound Name | 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione |
| PubChem CID | 80758039 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione |
| SMILES | CC1CSCCN1c1cc2c(cc1F)C(=O)C(=O)N2 |
| InChI | InChI=1S/C13H13FN2O2S/c1-7-6-19-3-2-16(7)11-5-10-8(4-9(11)14)12(17)13(18)15-10/h4-5,7H,2-3,6H2,1H3,(H,15,17,18) |
| InChIKey | IUMRYIRGXOBUPW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione?
The IUPAC name of 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione (CID 80758039) is 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione.
What is the SMILES notation for 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione?
The canonical SMILES for 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione is CC1CSCCN1c1cc2c(cc1F)C(=O)C(=O)N2.
What is the InChIKey of 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione?
The InChIKey is IUMRYIRGXOBUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O2S/c1-7-6-19-3-2-16(7)11-5-10-8(4-9(11)14)12(17)13(18)15-10/h4-5,7H,2-3,6H2,1H3,(H,15,17,18).
What are the key properties of 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione?
5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione has a molecular weight of 280.32 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-(3-methylthiomorpholin-4-yl)-1H-indole-2,3-dione is sourced from PubChem (CID 80758039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).