C14H15BrN2O2 — CID 79336319
5-bromo-6-(3,4-dimethylpyrrolidin-1-yl)-1H-indole-2,3-dione (PubChem CID 79336319) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 5-bromo-6-(3,4-dimethylpyrrolidin-1-yl)-1H-indole-2,3-dione.
| Compound Name | 5-bromo-6-(3,4-dimethylpyrrolidin-1-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79336319 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 5-bromo-6-(3,4-dimethylpyrrolidin-1-yl)-1H-indole-2,3-dione |
| SMILES | CC1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)CC1C |
| InChI | InChI=1S/C14H15BrN2O2/c1-7-5-17(6-8(7)2)12-4-11-9(3-10(12)15)13(18)14(19)16-11/h3-4,7-8H,5-6H2,1-2H3,(H,16,18,19) |
| InChIKey | FZAYQGCNGCHFID-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|