C14H17ClN2O2 — CID 79335937
5-chloro-6-(3,4-dimethylpyrrolidin-1-yl)-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 79335937) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 5-chloro-6-(3,4-dimethylpyrrolidin-1-yl)-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-6-(3,4-dimethylpyrrolidin-1-yl)-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79335937 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-chloro-6-(3,4-dimethylpyrrolidin-1-yl)-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CC1CN(c2cc3c(cc2Cl)C(O)C(=O)N3)CC1C |
| InChI | InChI=1S/C14H17ClN2O2/c1-7-5-17(6-8(7)2)12-4-11-9(3-10(12)15)13(18)14(19)16-11/h3-4,7-8,13,18H,5-6H2,1-2H3,(H,16,19) |
| InChIKey | GCSOXDWUBFOTOY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|