C12H13ClN2O3 — CID 79336696
5-chloro-3-hydroxy-6-(3-hydroxypyrrolidin-1-yl)-1,3-dihydroindol-2-one (PubChem CID 79336696) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 5-chloro-3-hydroxy-6-(3-hydroxypyrrolidin-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-hydroxy-6-(3-hydroxypyrrolidin-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79336696 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-chloro-3-hydroxy-6-(3-hydroxypyrrolidin-1-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(N3CCC(O)C3)c(Cl)cc2C1O |
| InChI | InChI=1S/C12H13ClN2O3/c13-8-3-7-9(14-12(18)11(7)17)4-10(8)15-2-1-6(16)5-15/h3-4,6,11,16-17H,1-2,5H2,(H,14,18) |
| InChIKey | KDTBYULSWYBZBR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|