C15H19ClN2O2S — CID 107456625
5-chloro-6-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 107456625) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 5-chloro-6-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-6-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 107456625 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-chloro-6-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CC1(C)CCN(c2cc3c(cc2Cl)C(O)C(=O)N3)CCS1 |
| InChI | InChI=1S/C15H19ClN2O2S/c1-15(2)3-4-18(5-6-21-15)12-8-11-9(7-10(12)16)13(19)14(20)17-11/h7-8,13,19H,3-6H2,1-2H3,(H,17,20) |
| InChIKey | OKPPPXWDGRCVCH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|