C14H17ClN2O3 — CID 79336349
5-chloro-6-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 79336349) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 5-chloro-6-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-6-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79336349 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-chloro-6-(2,2-dimethylmorpholin-4-yl)-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | CC1(C)CN(c2cc3c(cc2Cl)C(O)C(=O)N3)CCO1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-14(2)7-17(3-4-20-14)11-6-10-8(5-9(11)15)12(18)13(19)16-10/h5-6,12,18H,3-4,7H2,1-2H3,(H,16,19) |
| InChIKey | RQFBQIVFXRJMLK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|