C12H13FN2O3 — CID 80759185
5-fluoro-3-hydroxy-6-morpholin-4-yl-1,3-dihydroindol-2-one (PubChem CID 80759185) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is 5-fluoro-3-hydroxy-6-morpholin-4-yl-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-hydroxy-6-morpholin-4-yl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 80759185 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 5-fluoro-3-hydroxy-6-morpholin-4-yl-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(N3CCOCC3)c(F)cc2C1O |
| InChI | InChI=1S/C12H13FN2O3/c13-8-5-7-9(14-12(17)11(7)16)6-10(8)15-1-3-18-4-2-15/h5-6,11,16H,1-4H2,(H,14,17) |
| InChIKey | BBZCYCUTIRQYLO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|