C13H16N2O3 — CID 62974329
3-hydroxy-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one (PubChem CID 62974329) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-hydroxy-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one.
| Compound Name | 3-hydroxy-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 62974329 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-hydroxy-6-(1,4-oxazepan-4-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(N3CCCOCC3)ccc2C1O |
| InChI | InChI=1S/C13H16N2O3/c16-12-10-3-2-9(8-11(10)14-13(12)17)15-4-1-6-18-7-5-15/h2-3,8,12,16H,1,4-7H2,(H,14,17) |
| InChIKey | AXCYKVISPUERQF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|