C12H13N3O3 — CID 43586643
3-hydroxy-6-(3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one (PubChem CID 43586643) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-hydroxy-6-(3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 3-hydroxy-6-(3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43586643 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-hydroxy-6-(3-oxopiperazin-1-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1CN(c2ccc3c(c2)NC(=O)C3O)CCN1 |
| InChI | InChI=1S/C12H13N3O3/c16-10-6-15(4-3-13-10)7-1-2-8-9(5-7)14-12(18)11(8)17/h1-2,5,11,17H,3-4,6H2,(H,13,16)(H,14,18) |
| InChIKey | QCDSFLATROUUKJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|