C13H14BrN3O3 — CID 79336678
5-bromo-3-hydroxy-6-(3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one (PubChem CID 79336678) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is 5-bromo-3-hydroxy-6-(3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-hydroxy-6-(3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 79336678 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 5-bromo-3-hydroxy-6-(3-oxo-1,4-diazepan-1-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1CN(c2cc3c(cc2Br)C(O)C(=O)N3)CCCN1 |
| InChI | InChI=1S/C13H14BrN3O3/c14-8-4-7-9(16-13(20)12(7)19)5-10(8)17-3-1-2-15-11(18)6-17/h4-5,12,19H,1-3,6H2,(H,15,18)(H,16,20) |
| InChIKey | KDBALMHIXADIEU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|