C12H14N2O3 — CID 117005141
4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-2-one (PubChem CID 117005141) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-2-one.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-2-one |
|---|---|
| PubChem CID | 117005141 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-2-one |
| SMILES | O=C1CN(c2ccc3c(c2)OCCO3)CCN1 |
| InChI | InChI=1S/C12H14N2O3/c15-12-8-14(4-3-13-12)9-1-2-10-11(7-9)17-6-5-16-10/h1-2,7H,3-6,8H2,(H,13,15) |
| InChIKey | ZQPIUXKWNZYOEQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|