C23H27N3O3 — CID 160505049
4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-2-one (PubChem CID 160505049) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-2-one.
| Compound Name | 4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-2-one |
|---|---|
| PubChem CID | 160505049 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-2-one |
| SMILES | O=C1CN(c2ccc(CN3CCC[C@H]3c3ccc4c(c3)OCCO4)cc2)CCN1 |
| InChI | InChI=1S/C23H27N3O3/c27-23-16-25(11-9-24-23)19-6-3-17(4-7-19)15-26-10-1-2-20(26)18-5-8-21-22(14-18)29-13-12-28-21/h3-8,14,20H,1-2,9-13,15-16H2,(H,24,27)/t20-/m0/s1 |
| InChIKey | FDTYHHOREHWTLY-FQEVSTJZSA-N |
| XLogP | 2.73 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|