C25H31N3O3 — CID 146419412
1-[4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-1-yl]ethanone (PubChem CID 146419412) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 146419412 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-[4-[4-[[(2S)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CN3CCC[C@H]3c3ccc4c(c3)OCCO4)cc2)CC1 |
| InChI | InChI=1S/C25H31N3O3/c1-19(29)26-11-13-27(14-12-26)22-7-4-20(5-8-22)18-28-10-2-3-23(28)21-6-9-24-25(17-21)31-16-15-30-24/h4-9,17,23H,2-3,10-16,18H2,1H3/t23-/m0/s1 |
| InChIKey | HFWOUFOMZIVIBV-QHCPKHFHSA-N |
| XLogP | 3.46 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|