C13H16N2O3 — CID 115370868
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-diazinan-2-one (PubChem CID 115370868) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-diazinan-2-one.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115370868 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H16N2O3/c16-13-14-5-1-6-15(13)10-3-4-11-12(9-10)18-8-2-7-17-11/h3-4,9H,1-2,5-8H2,(H,14,16) |
| InChIKey | KUGSHMJTOKBRPW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |