C11H13ClN2O2 — CID 107623725
1-(4-chloro-3-methoxyphenyl)-1,3-diazinan-2-one (PubChem CID 107623725) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-1,3-diazinan-2-one.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 107623725 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-1,3-diazinan-2-one |
| SMILES | COc1cc(N2CCCNC2=O)ccc1Cl |
| InChI | InChI=1S/C11H13ClN2O2/c1-16-10-7-8(3-4-9(10)12)14-6-2-5-13-11(14)15/h3-4,7H,2,5-6H2,1H3,(H,13,15) |
| InChIKey | KRBMDRHEOMSLSN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |