C12H15ClN2O3 — CID 113296301
1-(4-chloro-2,5-dimethoxyphenyl)-1,3-diazinan-2-one (PubChem CID 113296301) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-1,3-diazinan-2-one.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 113296301 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-1,3-diazinan-2-one |
| SMILES | COc1cc(N2CCCNC2=O)c(OC)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O3/c1-17-10-7-9(11(18-2)6-8(10)13)15-5-3-4-14-12(15)16/h6-7H,3-5H2,1-2H3,(H,14,16) |
| InChIKey | OSZNCGRDOGUPPQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |