C12H12ClNO4 — CID 79517267
1-(5-chloro-2,4-dimethoxyphenyl)pyrrolidine-2,4-dione (PubChem CID 79517267) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)pyrrolidine-2,4-dione.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 79517267 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)pyrrolidine-2,4-dione |
| SMILES | COc1cc(OC)c(N2CC(=O)CC2=O)cc1Cl |
| InChI | InChI=1S/C12H12ClNO4/c1-17-10-5-11(18-2)9(4-8(10)13)14-6-7(15)3-12(14)16/h4-5H,3,6H2,1-2H3 |
| InChIKey | SJJKOQKQCICCPQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|