C13H15ClN2O4 — CID 79778169
1-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 79778169) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 79778169 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | COc1cc(OC)c(N2CC(C)C(=O)NC2=O)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O4/c1-7-6-16(13(18)15-12(7)17)9-4-8(14)10(19-2)5-11(9)20-3/h4-5,7H,6H2,1-3H3,(H,15,17,18) |
| InChIKey | RHEJUMYEJONSNV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |