C12H13BrN2O3 — CID 79777179
1-(3-bromo-4-methoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione (PubChem CID 79777179) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 79777179 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-5-methyl-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(N2CC(C)C(=O)NC2=O)cc1Br |
| InChI | InChI=1S/C12H13BrN2O3/c1-7-6-15(12(17)14-11(7)16)8-3-4-10(18-2)9(13)5-8/h3-5,7H,6H2,1-2H3,(H,14,16,17) |
| InChIKey | NOZIHYGLVFUXQK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |