C16H21ClN2O5S — CID 163312739
1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 163312739) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 163312739 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)sulfonyl-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | COc1cc(S(=O)(=O)N2CCCC23CCCNC3=O)c(OC)cc1Cl |
| InChI | InChI=1S/C16H21ClN2O5S/c1-23-12-10-14(13(24-2)9-11(12)17)25(21,22)19-8-4-6-16(19)5-3-7-18-15(16)20/h9-10H,3-8H2,1-2H3,(H,18,20) |
| InChIKey | OAIVWSCGWKFTMI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |