C10H10ClFN2O — CID 115371068
1-(4-chloro-3-fluorophenyl)-1,3-diazinan-2-one (PubChem CID 115371068) has the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-1,3-diazinan-2-one.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115371068 |
| Molecular Formula | C10H10ClFN2O |
| Molecular Weight | 228.65 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C10H10ClFN2O/c11-8-3-2-7(6-9(8)12)14-5-1-4-13-10(14)15/h2-3,6H,1,4-5H2,(H,13,15) |
| InChIKey | HYTPJUBYZUNGGK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.65 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |