C11H9NO5 — CID 117005555
4-(1,3-benzodioxol-5-yl)morpholine-2,3-dione (PubChem CID 117005555) has the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)morpholine-2,3-dione.
| Compound Name | 4-(1,3-benzodioxol-5-yl)morpholine-2,3-dione |
|---|---|
| PubChem CID | 117005555 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)morpholine-2,3-dione |
| SMILES | O=C1OCCN(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C11H9NO5/c13-10-11(14)15-4-3-12(10)7-1-2-8-9(5-7)17-6-16-8/h1-2,5H,3-4,6H2 |
| InChIKey | VCSGVWGAGNIQKJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|