C12H13NO4 — CID 117014053
1-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-2-one (PubChem CID 117014053) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-2-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-2-one |
|---|---|
| PubChem CID | 117014053 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-2-one |
| SMILES | O=C1CC(O)CCN1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13NO4/c14-9-3-4-13(12(15)6-9)8-1-2-10-11(5-8)17-7-16-10/h1-2,5,9,14H,3-4,6-7H2 |
| InChIKey | WLJUCYJEXULULG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |