C11H9NO5 — CID 82476080
1-(1,3-benzodioxol-5-yl)-2-oxoazetidine-3-carboxylic acid (PubChem CID 82476080) has the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-oxoazetidine-3-carboxylic acid.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-oxoazetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 82476080 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-oxoazetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C11H9NO5/c13-10-7(11(14)15)4-12(10)6-1-2-8-9(3-6)17-5-16-8/h1-3,7H,4-5H2,(H,14,15) |
| InChIKey | KGMOHDXUJPBOGW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|