C14H16N2O5 — CID 46588966
1-(1,3-benzodioxol-5-yl)-N-methoxy-N-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 46588966) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-methoxy-N-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-methoxy-N-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46588966 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-methoxy-N-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CON(C)C(=O)C1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C14H16N2O5/c1-15(19-2)14(18)9-5-13(17)16(7-9)10-3-4-11-12(6-10)21-8-20-11/h3-4,6,9H,5,7-8H2,1-2H3 |
| InChIKey | JDNDVPGUIIXPMY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|