C13H16N2O4 — CID 117026793
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(hydroxymethyl)piperazin-2-one (PubChem CID 117026793) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(hydroxymethyl)piperazin-2-one.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(hydroxymethyl)piperazin-2-one |
|---|---|
| PubChem CID | 117026793 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-(hydroxymethyl)piperazin-2-one |
| SMILES | O=C1CN(c2ccc3c(c2)OCCO3)CC(CO)N1 |
| InChI | InChI=1S/C13H16N2O4/c16-8-9-6-15(7-13(17)14-9)10-1-2-11-12(5-10)19-4-3-18-11/h1-2,5,9,16H,3-4,6-8H2,(H,14,17) |
| InChIKey | XFWPNGSVBGVJDV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|