C14H18N2O3 — CID 117008299
1-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-carboxamide (PubChem CID 117008299) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 117008299 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C14H18N2O3/c15-14(17)10-2-1-5-16(9-10)11-3-4-12-13(8-11)19-7-6-18-12/h3-4,8,10H,1-2,5-7,9H2,(H2,15,17) |
| InChIKey | UXZAQFXNUMOZRE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|