C12H16N2O2 — CID 82038534
(3S)-1-(1,3-benzodioxol-5-yl)piperidin-3-amine (PubChem CID 82038534) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (3S)-1-(1,3-benzodioxol-5-yl)piperidin-3-amine.
| Compound Name | (3S)-1-(1,3-benzodioxol-5-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 82038534 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (3S)-1-(1,3-benzodioxol-5-yl)piperidin-3-amine |
| SMILES | N[C@H]1CCCN(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C12H16N2O2/c13-9-2-1-5-14(7-9)10-3-4-11-12(6-10)16-8-15-11/h3-4,6,9H,1-2,5,7-8,13H2/t9-/m0/s1 |
| InChIKey | ILNUSTALTMQZCN-VIFPVBQESA-N |
| XLogP | 1.34 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|