C19H22N2O2 — CID 83993803
1-(1,3-benzodioxol-5-yl)-N-benzylpiperidin-3-amine (PubChem CID 83993803) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-benzylpiperidin-3-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-benzylpiperidin-3-amine |
|---|---|
| PubChem CID | 83993803 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-benzylpiperidin-3-amine |
| SMILES | c1ccc(CNC2CCCN(c3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-2-5-15(6-3-1)12-20-16-7-4-10-21(13-16)17-8-9-18-19(11-17)23-14-22-18/h1-3,5-6,8-9,11,16,20H,4,7,10,12-14H2 |
| InChIKey | DRGPAVWIQFPXSY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|