C24H28N4O2S — CID 26411291
(3S)-N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-(1,3-benzothiazol-2-yl)piperidin-3-amine (PubChem CID 26411291) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is (3S)-N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-(1,3-benzothiazol-2-yl)piperidin-3-amine.
| Compound Name | (3S)-N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-(1,3-benzothiazol-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 26411291 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (3S)-N-[1-(1,3-benzodioxol-5-yl)piperidin-4-yl]-1-(1,3-benzothiazol-2-yl)piperidin-3-amine |
| SMILES | c1ccc2sc(N3CCC[C@H](NC4CCN(c5ccc6c(c5)OCO6)CC4)C3)nc2c1 |
| InChI | InChI=1S/C24H28N4O2S/c1-2-6-23-20(5-1)26-24(31-23)28-11-3-4-18(15-28)25-17-9-12-27(13-10-17)19-7-8-21-22(14-19)30-16-29-21/h1-2,5-8,14,17-18,25H,3-4,9-13,15-16H2/t18-/m0/s1 |
| InChIKey | LEWGBCZYHISRKZ-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|