C19H24N2 — CID 83993791
N-benzyl-1-(4-methylphenyl)piperidin-3-amine (PubChem CID 83993791) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is N-benzyl-1-(4-methylphenyl)piperidin-3-amine.
| Compound Name | N-benzyl-1-(4-methylphenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 83993791 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-benzyl-1-(4-methylphenyl)piperidin-3-amine |
| SMILES | Cc1ccc(N2CCCC(NCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H24N2/c1-16-9-11-19(12-10-16)21-13-5-8-18(15-21)20-14-17-6-3-2-4-7-17/h2-4,6-7,9-12,18,20H,5,8,13-15H2,1H3 |
| InChIKey | CVMYJXYHNKEIPP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|