C18H27N3O2S — CID 166271940
(1S,5R)-N-[1-(4-methylphenyl)piperidin-3-yl]-3-azabicyclo[3.2.0]heptane-3-sulfonamide (PubChem CID 166271940) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (1S,5R)-N-[1-(4-methylphenyl)piperidin-3-yl]-3-azabicyclo[3.2.0]heptane-3-sulfonamide.
| Compound Name | (1S,5R)-N-[1-(4-methylphenyl)piperidin-3-yl]-3-azabicyclo[3.2.0]heptane-3-sulfonamide |
|---|---|
| PubChem CID | 166271940 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (1S,5R)-N-[1-(4-methylphenyl)piperidin-3-yl]-3-azabicyclo[3.2.0]heptane-3-sulfonamide |
| SMILES | Cc1ccc(N2CCCC(NS(=O)(=O)N3C[C@H]4CC[C@H]4C3)C2)cc1 |
| InChI | InChI=1S/C18H27N3O2S/c1-14-4-8-18(9-5-14)20-10-2-3-17(13-20)19-24(22,23)21-11-15-6-7-16(15)12-21/h4-5,8-9,15-17,19H,2-3,6-7,10-13H2,1H3/t15-,16+,17? |
| InChIKey | GJFBMYCLTMXFOJ-SJPCQFCGSA-N |
| XLogP | 2.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|