C17H25N3O2 — CID 125138833
(2R,4S)-4-hydroxy-N-[(3S)-1-(4-methylphenyl)piperidin-3-yl]pyrrolidine-2-carboxamide (PubChem CID 125138833) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (2R,4S)-4-hydroxy-N-[(3S)-1-(4-methylphenyl)piperidin-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-4-hydroxy-N-[(3S)-1-(4-methylphenyl)piperidin-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 125138833 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2R,4S)-4-hydroxy-N-[(3S)-1-(4-methylphenyl)piperidin-3-yl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(N2CCC[C@H](NC(=O)[C@H]3C[C@H](O)CN3)C2)cc1 |
| InChI | InChI=1S/C17H25N3O2/c1-12-4-6-14(7-5-12)20-8-2-3-13(11-20)19-17(22)16-9-15(21)10-18-16/h4-7,13,15-16,18,21H,2-3,8-11H2,1H3,(H,19,22)/t13-,15-,16+/m0/s1 |
| InChIKey | HPMFPUKJICAGTG-CWRNSKLLSA-N |
| XLogP | 0.80 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|