C24H29N3O3 — CID 86966191
N-[1-(3-methoxyphenyl)piperidin-3-yl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 86966191) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)piperidin-3-yl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[1-(3-methoxyphenyl)piperidin-3-yl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86966191 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[1-(3-methoxyphenyl)piperidin-3-yl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cccc(N2CCCC(NC(=O)C3CCN(c4ccc(C)cc4)C3=O)C2)c1 |
| InChI | InChI=1S/C24H29N3O3/c1-17-8-10-19(11-9-17)27-14-12-22(24(27)29)23(28)25-18-5-4-13-26(16-18)20-6-3-7-21(15-20)30-2/h3,6-11,15,18,22H,4-5,12-14,16H2,1-2H3,(H,25,28) |
| InChIKey | XJFPCCRIPMSPTI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|