C16H22N2O3 — CID 93330707
(3S)-N-[(2R)-butan-2-yl]-1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 93330707) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3S)-N-[(2R)-butan-2-yl]-1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(2R)-butan-2-yl]-1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93330707 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (3S)-N-[(2R)-butan-2-yl]-1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H]1CCN(c2cccc(OC)c2)C1=O |
| InChI | InChI=1S/C16H22N2O3/c1-4-11(2)17-15(19)14-8-9-18(16(14)20)12-6-5-7-13(10-12)21-3/h5-7,10-11,14H,4,8-9H2,1-3H3,(H,17,19)/t11-,14+/m1/s1 |
| InChIKey | HIZUMQWVLQXYFK-RISCZKNCSA-N |
| XLogP | 1.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|