C24H26N2O8 — CID 66831918
1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 66831918) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 66831918 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | COc1cccc(N2CCC(C(=O)O)C2=O)c1.COc1cccc(N2CCC(C(=O)O)C2=O)c1 |
| InChI | InChI=1S/2C12H13NO4/c2*1-17-9-4-2-3-8(7-9)13-6-5-10(11(13)14)12(15)16/h2*2-4,7,10H,5-6H2,1H3,(H,15,16) |
| InChIKey | RQNQTFCJQUSWNQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|