C18H23BrN2O4 — CID 55871218
methyl 2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoate (PubChem CID 55871218) has the molecular formula C18H23BrN2O4 and a molecular weight of 411.30 g/mol. Its IUPAC name is methyl 2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 55871218 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | methyl 2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C1CCN(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C18H23BrN2O4/c1-11(2)9-15(18(24)25-3)20-16(22)14-7-8-21(17(14)23)13-6-4-5-12(19)10-13/h4-6,10-11,14-15H,7-9H2,1-3H3,(H,20,22) |
| InChIKey | IZBOBSHVEJHKKV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|