C17H21BrN2O4 — CID 119364643
(2R)-2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119364643) has the molecular formula C17H21BrN2O4 and a molecular weight of 397.27 g/mol. Its IUPAC name is (2R)-2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119364643 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (2R)-2-[[1-(3-bromophenyl)-2-oxopyrrolidine-3-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)C1CCN(c2cccc(Br)c2)C1=O)C(=O)O |
| InChI | InChI=1S/C17H21BrN2O4/c1-10(2)8-14(17(23)24)19-15(21)13-6-7-20(16(13)22)12-5-3-4-11(18)9-12/h3-5,9-10,13-14H,6-8H2,1-2H3,(H,19,21)(H,23,24)/t13?,14-/m1/s1 |
| InChIKey | WXRMDLQRTMYYOL-ARLHGKGLSA-N |
| XLogP | 2.42 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|