C17H21ClN2O4 — CID 120614725
(2S)-2-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]hexanoic acid (PubChem CID 120614725) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is (2S)-2-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120614725 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (2S)-2-[[1-(3-chlorophenyl)-2-oxopyrrolidine-3-carbonyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C1CCN(c2cccc(Cl)c2)C1=O)C(=O)O |
| InChI | InChI=1S/C17H21ClN2O4/c1-2-3-7-14(17(23)24)19-15(21)13-8-9-20(16(13)22)12-6-4-5-11(18)10-12/h4-6,10,13-14H,2-3,7-9H2,1H3,(H,19,21)(H,23,24)/t13?,14-/m0/s1 |
| InChIKey | SGFAPNYYEFOEHB-KZUDCZAMSA-N |
| XLogP | 2.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|