C16H20ClN3O2 — CID 119615310
N-(2-amino-1-cyclopropylethyl)-1-(3-chlorophenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 119615310) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-1-(3-chlorophenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-1-(3-chlorophenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119615310 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-1-(3-chlorophenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | NCC(NC(=O)C1CCN(c2cccc(Cl)c2)C1=O)C1CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c17-11-2-1-3-12(8-11)20-7-6-13(16(20)22)15(21)19-14(9-18)10-4-5-10/h1-3,8,10,13-14H,4-7,9,18H2,(H,19,21) |
| InChIKey | LBAGAPOGSSKKDN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|