C16H19ClN2O3 — CID 125137384
methyl (2S)-2-[[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]amino]-2-cyclopropylacetate (PubChem CID 125137384) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is methyl (2S)-2-[[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]amino]-2-cyclopropylacetate.
| Compound Name | methyl (2S)-2-[[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]amino]-2-cyclopropylacetate |
|---|---|
| PubChem CID | 125137384 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | methyl (2S)-2-[[(3S)-1-(3-chlorophenyl)-2-oxopyrrolidin-3-yl]amino]-2-cyclopropylacetate |
| SMILES | COC(=O)[C@@H](N[C@H]1CCN(c2cccc(Cl)c2)C1=O)C1CC1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-22-16(21)14(10-5-6-10)18-13-7-8-19(15(13)20)12-4-2-3-11(17)9-12/h2-4,9-10,13-14,18H,5-8H2,1H3/t13-,14-/m0/s1 |
| InChIKey | LVFSSYVIVCAKSQ-KBPBESRZSA-N |
| XLogP | 1.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |